EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H18N2O2 |
| Net Charge | 0 |
| Average Mass | 222.288 |
| Monoisotopic Mass | 222.13683 |
| SMILES | CCCCCOc1ccc(C(=O)NN)cc1 |
| InChI | InChI=1S/C12H18N2O2/c1-2-3-4-9-16-11-7-5-10(6-8-11)12(15)14-13/h5-8H,2-4,9,13H2,1H3,(H,14,15) |
| InChIKey | ZJYYDMKIBGAUCA-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-(pentyloxy)benzene-1-carbohydrazide (CHEBI:183446) is a benzoic acids (CHEBI:22723) |
| IUPAC Name |
|---|
| 4-pentoxybenzohydrazide |
| Manual Xrefs | Databases |
|---|---|
| 2009717 | ChemSpider |