EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H12O3 |
| Net Charge | 0 |
| Average Mass | 192.214 |
| Monoisotopic Mass | 192.07864 |
| SMILES | O=C(O)CCC(=O)Cc1ccccc1 |
| InChI | InChI=1S/C11H12O3/c12-10(6-7-11(13)14)8-9-4-2-1-3-5-9/h1-5H,6-8H2,(H,13,14) |
| InChIKey | LTNSOYZGFPWHOF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-oxo-5-phenylpentanoic acid (CHEBI:183438) is a oxo carboxylic acid (CHEBI:25754) |
| IUPAC Name |
|---|
| 4-oxo-5-phenylpentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 8550754 | ChemSpider |