EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H19NO4 |
| Net Charge | 0 |
| Average Mass | 265.309 |
| Monoisotopic Mass | 265.13141 |
| SMILES | COCC(=O)N(c1c(C)cccc1C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C14H19NO4/c1-9-6-5-7-10(2)13(9)15(11(3)14(17)18)12(16)8-19-4/h5-7,11H,8H2,1-4H3,(H,17,18)/t11-/m0/s1 |
| InChIKey | ZRIKZVLHMGYCIR-NSHDSACASA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N-(2,6-Dimethylphenyl)-N-(methoxyacetyl) alanine (CHEBI:183423) is a N-acyl-L-amino acid (CHEBI:21644) |
| IUPAC Name |
|---|
| (2S)-2-(N-(2-methoxyacetyl)-2,6-dimethylanilino)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 139976 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:87764-37-2 | ChemIDplus |