EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30O2 |
| Net Charge | 0 |
| Average Mass | 314.469 |
| Monoisotopic Mass | 314.22458 |
| SMILES | [H][C@@]12CC(C)=CC[C@@]1([H])C(C)(C)Oc1cc(CCCCC)cc(O)c12 |
| InChI | InChI=1S/C21H30O2/c1-5-6-7-8-15-12-18(22)20-16-11-14(2)9-10-17(16)21(3,4)23-19(20)13-15/h9,12-13,16-17,22H,5-8,10-11H2,1-4H3/t16-,17-/m1/s1 |
| InChIKey | HCAWPGARWVBULJ-IAGOWNOFSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Application: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| delta8-THC (CHEBI:183415) has role antineoplastic agent (CHEBI:35610) |
| delta8-THC (CHEBI:183415) is a 1-benzopyran (CHEBI:38443) |
| IUPAC Name |
|---|
| (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,10,10a-tetrahydrobenzo[c]chromen-1-ol |
| Synonyms | Source |
|---|---|
| 8-tetrahydrocannabinol | ChEMBL |
| .delta.6-thc | ChEMBL |
| .delta.-8-tetrahydrocannabinol | ChEMBL |
| .delta.8-tetrahydrocannabinol | ChEMBL |
| delta-8-tetrahydrocannabinol | ChEMBL |
| Delta 8-tetrahydrocannabinol | ChEMBL |
| Citations |
|---|