EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H13NO2 |
| Net Charge | 0 |
| Average Mass | 215.252 |
| Monoisotopic Mass | 215.09463 |
| SMILES | N[C@H](Cc1ccc2ccccc2c1)C(=O)O |
| InChI | InChI=1S/C13H13NO2/c14-12(13(15)16)8-9-5-6-10-3-1-2-4-11(10)7-9/h1-7,12H,8,14H2,(H,15,16)/t12-/m1/s1 |
| InChIKey | JPZXHKDZASGCLU-GFCCVEGCSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 3-naphthalen-2-yl-D-alanine (CHEBI:183401) is a 3-naphthalen-2-ylalanine (CHEBI:229533) |
| 3-naphthalen-2-yl-D-alanine (CHEBI:183401) is enantiomer of 3-naphthalen-2-yl-L-alanine (CHEBI:44170) |
| Incoming Relation(s) |
| 3-naphthalen-2-yl-L-alanine (CHEBI:44170) is enantiomer of 3-naphthalen-2-yl-D-alanine (CHEBI:183401) |
| IUPAC Name |
|---|
| 3-naphthalen-2-yl-D-alanine |
| Synonyms | Source |
|---|---|
| (2R)-2-amino-3-naphthalen-2-ylpropanoic acid | ChEBI |
| (2R)-2-amino-3-(naphthalen-2-yl)propanoic acid | IUPAC |
| 3-(2-naphthyl)-D-alanine | ChEBI |
| (R)-2-amino-3-(naphthalen-2-yl)propanoic acid | ChEBI |
| D-3-(2-naphthyl)alanine | ChEBI |
| D-β-(2-naphthyl)alanine | ChEBI |
| Citations |
|---|