EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H27FN2O2 |
| Net Charge | 0 |
| Average Mass | 370.468 |
| Monoisotopic Mass | 370.20566 |
| SMILES | COCC(=O)N(c1ccccc1F)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C22H27FN2O2/c1-27-17-22(26)25(21-10-6-5-9-20(21)23)19-12-15-24(16-13-19)14-11-18-7-3-2-4-8-18/h2-10,19H,11-17H2,1H3 |
| InChIKey | NYISTOZKVCMVEL-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| ocfentanyl (CHEBI:183384) has role opioid analgesic (CHEBI:35482) |
| ocfentanyl (CHEBI:183384) has role μ-opioid receptor agonist (CHEBI:55322) |
| ocfentanyl (CHEBI:183384) is a ether (CHEBI:25698) |
| ocfentanyl (CHEBI:183384) is a monocarboxylic acid amide (CHEBI:29347) |
| ocfentanyl (CHEBI:183384) is a monofluorobenzenes (CHEBI:83575) |
| ocfentanyl (CHEBI:183384) is a piperidines (CHEBI:26151) |
| ocfentanyl (CHEBI:183384) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(2-fluorophenyl)-2-methoxy-N-[1-(2-phenylethyl)piperidin-4-yl]acetamide |
| INNs | Source |
|---|---|
| ocfentanil | WHO MedNet |
| ocfentanil | WHO MedNet |
| ocfentanilum | WHO MedNet |
| ocfentanilo | WHO MedNet |
| Synonyms | Source |
|---|---|
| N-(2-fluorophenyl)-2-methoxy-N-[1-(2-phenylethyl)-4-piperidinyl]acetamide | ChEBI |
| A-3217 | ChEBI |
| ortho-fluoro methoxyacetyl fentanyl | ChEBI |
| o-fluoro methoxyacetyl fentanyl | ChEBI |
| o-fluoro MAF | ChEBI |
| ortho-fluoro MAF | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 54604 | ChemSpider |
| HMDB0255884 | HMDB |
| Ocfentanil | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:101343-69-5 | ChEBI |
| Citations |
|---|