EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H32N2O2 |
| Net Charge | 0 |
| Average Mass | 380.532 |
| Monoisotopic Mass | 380.24638 |
| SMILES | CCCC(=O)N(c1ccc(OC)cc1)C1CCN(CCc2ccccc2)CC1 |
| InChI | InChI=1S/C24H32N2O2/c1-3-7-24(27)26(21-10-12-23(28-2)13-11-21)22-15-18-25(19-16-22)17-14-20-8-5-4-6-9-20/h4-6,8-13,22H,3,7,14-19H2,1-2H3 |
| InChIKey | FNVSEQCPMXWQKG-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Roles: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| Applications: | mu-opioid receptor agonist A compound that exhibits agonist activity at the μ-opioid receptor. opioid analgesic A narcotic or opioid substance, synthetic or semisynthetic agent producing profound analgesia, drowsiness, and changes in mood. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 4-methoxybutyrfentanyl (CHEBI:183351) has role opioid analgesic (CHEBI:35482) |
| 4-methoxybutyrfentanyl (CHEBI:183351) has role μ-opioid receptor agonist (CHEBI:55322) |
| 4-methoxybutyrfentanyl (CHEBI:183351) is a monocarboxylic acid amide (CHEBI:29347) |
| 4-methoxybutyrfentanyl (CHEBI:183351) is a monomethoxybenzene (CHEBI:25235) |
| 4-methoxybutyrfentanyl (CHEBI:183351) is a piperidines (CHEBI:26151) |
| 4-methoxybutyrfentanyl (CHEBI:183351) is a tertiary amino compound (CHEBI:50996) |
| IUPAC Name |
|---|
| N-(4-methoxyphenyl)-N-[1-(2-phenylethyl)piperidin-4-yl]butanamide |
| Synonyms | Source |
|---|---|
| 4-MeO-BF | ChEBI |
| 4-MeO-butyrfentanyl | ChEBI |
| 4-OMe-butyrfentanyl | ChEBI |
| N-(4-methoxyphenyl)-N-[1-(2-phenylethyl)-4-piperidinyl]butanamide | ChEBI |
| para-methoxy-butyryl fentanyl | ChEBI |
| para-methoxybutyryl fentanyl | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| 4-Methoxybutyrfentanyl | Wikipedia |
| 52085457 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:2088842-68-4 | ChEBI |
| Citations |
|---|