EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30O4 |
| Net Charge | 0 |
| Average Mass | 310.434 |
| Monoisotopic Mass | 310.21441 |
| SMILES | CC/C=C\CC(/C=C/C=C/CCCCCCCC(=O)O)OO |
| InChI | InChI=1S/C18H30O4/c1-2-3-11-14-17(22-21)15-12-9-7-5-4-6-8-10-13-16-18(19)20/h3,7,9,11-12,15,17,21H,2,4-6,8,10,13-14,16H2,1H3,(H,19,20)/b9-7+,11-3-,15-12+ |
| InChIKey | UYQGVDXDXBAABN-SKEAHQKTSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Bombus terrestris (ncbitaxon:30195) | |||
| brain (BTO:0000142) | MetaboLights (MTBLS3637) | ||
| hemolymph (BTO:0000572) | MetaboLights (MTBLS3637) | ||
| hindgut (BTO:0000510) | MetaboLights (MTBLS3637) | ||
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) | |
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 13-Hpotre(R) (CHEBI:183350) is a hydroperoxy polyunsaturated fatty acid (CHEBI:189832) |
| 13-Hpotre(R) (CHEBI:183350) is a octadecatrienoic acid (CHEBI:25633) |
| IUPAC Names |
|---|
| (9E,11E,15Z)-13-hydroperoxyoctadeca-9,11,15-trienoic acid |
| (6Z,9Z,11E,13S)-13-hydroperoxyoctadeca-6,9,11-trienoic acid |
| Manual Xrefs | Databases |
|---|---|
| LMFA02000110 | LIPID MAPS |
| 24608106 | ChemSpider |