EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H15P |
| Net Charge | 0 |
| Average Mass | 262.292 |
| Monoisotopic Mass | 262.09114 |
| SMILES | c1ccc(P(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15P/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18/h1-15H |
| InChIKey | RIOQSEWOXXDEQQ-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | reducing agent The element or compound in a reduction-oxidation (redox) reaction that donates an electron to another species. catalyst A substance that increases the rate of a reaction without modifying the overall standard Gibbs energy change in the reaction. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| triphenylphosphine (CHEBI:183318) has role reducing agent (CHEBI:63247) |
| triphenylphosphine (CHEBI:183318) is a benzenes (CHEBI:22712) |
| triphenylphosphine (CHEBI:183318) is a tertiary phosphine (CHEBI:35886) |
| IUPAC Name |
|---|
| triphenylphosphane |
| Synonyms | Source |
|---|---|
| Triphenylphosphan | SUBMITTER |
| Triphenylphosphin | SUBMITTER |
| triphenylphosphide | ChemIDplus |
| triphenylphosphorus | ChemIDplus |
| triphenyl phosphine | ChemIDplus |
| PPh3 | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| Triphenylphosphine | Wikipedia |
| HMDB0259265 | HMDB |
| 11283 | ChemSpider |
| Citations |
|---|