EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H24B2O4 |
| Net Charge | 0 |
| Average Mass | 253.944 |
| Monoisotopic Mass | 254.18607 |
| SMILES | CC1(C)OB(B2OC(C)(C)C(C)(C)O2)OC1(C)C |
| InChI | InChI=1S/C12H24B2O4/c1-9(2)10(3,4)16-13(15-9)14-17-11(5,6)12(7,8)18-14/h1-8H3 |
| InChIKey | IPWKHHSGDUIRAH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Role: | EC 3.4.24.24 (gelatinase A) inhibitor An EC 3.4.24.* (metalloendopeptidase) inhibitor that interferes with the action of gelatinase A (EC 3.4.24.24). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| bis(pinacolato)diboron (CHEBI:183312) has role EC 3.4.24.24 (gelatinase A) inhibitor (CHEBI:84036) |
| bis(pinacolato)diboron (CHEBI:183312) is a 1,3,2-dioxaborolane (CHEBI:51636) |
| IUPAC Name |
|---|
| 4,4,4',4',5,5,5',5'-octamethyl-2,2'-bi-1,3,2-dioxaborolane |
| Synonyms | Source |
|---|---|
| octamethyl-2,2'-bi(1,3,2-dioxaborolane) | ChEBI |
| bis(pinacolato)diborane | ChemIDplus |
| B2pin2 | ChemIDplus |
| dipinacoldiboron | ChemIDplus |
| diboron pinacol ester | ChemIDplus |
| 4,4,5,5-tetramethyl-2-(4,4,5,5-tetramethyl-1,3,2- dioxaborolan-2-yl)-1,3,2-dioxaborolane | IUPAC |
| Manual Xrefs | Databases |
|---|---|
| Bis(pinacolato)diboron | Wikipedia |
| 2015334 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| Reaxys:7703552 | Reaxys |
| CAS:73183-34-3 | ChemIDplus |
| Citations |
|---|