EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C12H22O4 |
| Net Charge | 0 |
| Average Mass | 230.304 |
| Monoisotopic Mass | 230.15181 |
| SMILES | CCCCCCCOC(=O)C(=O)OCCC |
| InChI | InChI=1S/C12H22O4/c1-3-5-6-7-8-10-16-12(14)11(13)15-9-4-2/h3-10H2,1-2H3 |
| InChIKey | WTLUAUFKSDHGHB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Homo sapiens (ncbitaxon:9606) | blood plasma (BTO:0000131) | MetaboLights (MTBLS1866) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Oxalic acid, heptyl propyl ester (CHEBI:183306) is a dicarboxylic acid (CHEBI:35692) |
| IUPAC Name |
|---|
| 2-O-heptyl 1-O-propyl oxalate |
| Manual Xrefs | Databases |
|---|---|
| 4926248 | ChemSpider |