EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H17N3O5 |
| Net Charge | 0 |
| Average Mass | 247.251 |
| Monoisotopic Mass | 247.11682 |
| SMILES | C[C@@H](O)[C@H](NC(=O)[C@@H](N)CCC(N)=O)C(=O)O |
| InChI | InChI=1S/C9H17N3O5/c1-4(13)7(9(16)17)12-8(15)5(10)2-3-6(11)14/h4-5,7,13H,2-3,10H2,1H3,(H2,11,14)(H,12,15)(H,16,17)/t4-,5+,7+/m1/s1 |
| InChIKey | HHSJMSCOLJVTCX-ZDLURKLDSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Anopheles gambiae (ncbitaxon:7165) | Whole body (BTO:0001489) | MetaboLights (MTBLS1282) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| L-Glutaminyl-L-threonine (CHEBI:183242) is a dipeptide (CHEBI:46761) |
| IUPAC Name |
|---|
| (2S,3R)-2-[[(2S)-2,5-diamino-5-oxopentanoyl]amino]-3-hydroxybutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 57560809 | ChemSpider |
| HMDB0028807 | HMDB |