EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:183231 - 6-diazo-5-oxo-L-norleucine zwitterion
| Formula | C6H9N3O3 |
| Net Charge | 0 |
| Average Mass | 171.156 |
| Monoisotopic Mass | 171.06439 |
| SMILES | [N-]=[N+]=CC(=O)CC[C@H]([NH3+])C(=O)[O-] |
| InChI | InChI=1S/C6H9N3O3/c7-5(6(11)12)2-1-4(10)3-9-8/h3,5H,1-2,7H2,(H,11,12)/t5-/m0/s1 |
| InChIKey | YCWQAMGASJSUIP-YFKPBYRVSA-N |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6-diazo-5-oxo-L-norleucine zwitterion (CHEBI:183231) is a amino-acid zwitterion (CHEBI:35238) |
| 6-diazo-5-oxo-L-norleucine zwitterion (CHEBI:183231) is tautomer of 6-diazo-5-oxo-L-norleucine (CHEBI:138889) |
| Incoming Relation(s) |
| 6-diazo-5-oxo-L-norleucine (CHEBI:138889) is tautomer of 6-diazo-5-oxo-L-norleucine zwitterion (CHEBI:183231) |
| UniProt Name | Source |
|---|---|
| 6-diazo-5-oxo-L-norleucine | UniProt |
| Manual Xrefs | Databases |
|---|---|
| CPD0-1627 | MetaCyc |
| Citations |
|---|