EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H34N4O11 |
| Net Charge | 0 |
| Average Mass | 602.597 |
| Monoisotopic Mass | 602.22241 |
| SMILES | NC(CCC(=O)O)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccc(O)cc1)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C28H34N4O11/c29-19(9-11-23(35)36)25(39)30-20(10-12-24(37)38)26(40)31-21(13-15-1-5-17(33)6-2-15)27(41)32-22(28(42)43)14-16-3-7-18(34)8-4-16/h1-8,19-22,33-34H,9-14,29H2,(H,30,39)(H,31,40)(H,32,41)(H,35,36)(H,37,38)(H,42,43) |
| InChIKey | QBLCUWAGTGRXAY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Glu-Glu-Tyr-Tyr (CHEBI:183215) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 4-amino-5-[[4-carboxy-1-[[1-[[1-carboxy-2-(4-hydroxyphenyl)ethyl]amino]-3-(4-hydroxyphenyl)-1-oxopropan-2-yl]amino]-1-oxobutan-2-yl]amino]-5-oxopentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16618365 | ChemSpider |