EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H30N8O7S |
| Net Charge | 0 |
| Average Mass | 514.565 |
| Monoisotopic Mass | 514.19582 |
| SMILES | CSCCC(NC(=O)C(N)CC(N)=O)C(=O)NC(CC(N)=O)C(=O)NC(Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C19H30N8O7S/c1-35-3-2-11(25-16(30)10(20)5-14(21)28)17(31)26-12(6-15(22)29)18(32)27-13(19(33)34)4-9-7-23-8-24-9/h7-8,10-13H,2-6,20H2,1H3,(H2,21,28)(H2,22,29)(H,23,24)(H,25,30)(H,26,31)(H,27,32)(H,33,34) |
| InChIKey | NKFGQWVYETUWGU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Met-Asn-His (CHEBI:183213) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[[4-amino-2-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-4-methylsulanylbutanoyl]amino]-4-oxobutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16596880 | ChemSpider |