EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C22H34N4O6S2 |
| Net Charge | 0 |
| Average Mass | 514.670 |
| Monoisotopic Mass | 514.19198 |
| SMILES | CSCCC(NC(=O)C(C)N)C(=O)NC(CCSC)C(=O)NC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C22H34N4O6S2/c1-13(23)19(28)24-16(8-10-33-2)20(29)25-17(9-11-34-3)21(30)26-18(22(31)32)12-14-4-6-15(27)7-5-14/h4-7,13,16-18,27H,8-12,23H2,1-3H3,(H,24,28)(H,25,29)(H,26,30)(H,31,32) |
| InChIKey | ODLLXUGPBCQRPF-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Met-Met-Tyr (CHEBI:183199) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[[2-[[2-(2-aminopropanoylamino)-4-methylsulanylbutanoyl]amino]-4-methylsulanylbutanoyl]amino]-3-(4-hydroxyphenyl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16581137 | ChemSpider |