EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H32N4O5S2 |
| Net Charge | 0 |
| Average Mass | 484.644 |
| Monoisotopic Mass | 484.18141 |
| SMILES | CC(C)CC(NC(=O)C(N)CS)C(=O)NC(Cc1ccccc1)C(=O)NC(CS)C(=O)O |
| InChI | InChI=1S/C21H32N4O5S2/c1-12(2)8-15(23-18(26)14(22)10-31)19(27)24-16(9-13-6-4-3-5-7-13)20(28)25-17(11-32)21(29)30/h3-7,12,14-17,31-32H,8-11,22H2,1-2H3,(H,23,26)(H,24,27)(H,25,28)(H,29,30) |
| InChIKey | CIBLYQCAZRYWHY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cys-Leu-Phe-Cys (CHEBI:183195) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[[2-[[2-[(2-amino-3-sulanylpropanoyl)amino]-4-methylpentanoyl]amino]-3-phenylpropanoyl]amino]-3-sulanylpropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16612274 | ChemSpider |