EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C24H36N4O6 |
| Net Charge | 0 |
| Average Mass | 476.574 |
| Monoisotopic Mass | 476.26348 |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1ccccc1)C(=O)NC(C(=O)N1CCCC1C(=O)O)C(C)O |
| InChI | InChI=1S/C24H36N4O6/c1-4-14(2)19(25)22(31)26-17(13-16-9-6-5-7-10-16)21(30)27-20(15(3)29)23(32)28-12-8-11-18(28)24(33)34/h5-7,9-10,14-15,17-20,29H,4,8,11-13,25H2,1-3H3,(H,26,31)(H,27,30)(H,33,34) |
| InChIKey | XGPNARQELVNWIP-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ile-Phe-Thr-Pro (CHEBI:183193) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 1-[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-hydroxybutanoyl]pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 16653396 | ChemSpider |