EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H30N6O6S2 |
| Net Charge | 0 |
| Average Mass | 490.608 |
| Monoisotopic Mass | 490.16682 |
| SMILES | CSCCC(NC(=O)C(N)CS)C(=O)NC(C(=O)NC(Cc1cncn1)C(=O)O)C(C)O |
| InChI | InChI=1S/C18H30N6O6S2/c1-9(25)14(17(28)23-13(18(29)30)5-10-6-20-8-21-10)24-16(27)12(3-4-32-2)22-15(26)11(19)7-31/h6,8-9,11-14,25,31H,3-5,7,19H2,1-2H3,(H,20,21)(H,22,26)(H,23,28)(H,24,27)(H,29,30) |
| InChIKey | NIIKKIWKXWWGRB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Cys-Met-Thr-His (CHEBI:183177) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[[2-[[2-[(2-amino-3-sulanylpropanoyl)amino]-4-methylsulanylbutanoyl]amino]-3-hydroxybutanoyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16613138 | ChemSpider |