EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C35H41N5O5 |
| Net Charge | 0 |
| Average Mass | 611.743 |
| Monoisotopic Mass | 611.31077 |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1ccccc1)C(=O)NC(Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C35H41N5O5/c1-3-22(2)31(36)34(43)39-29(19-24-14-8-5-9-15-24)32(41)38-28(18-23-12-6-4-7-13-23)33(42)40-30(35(44)45)20-25-21-37-27-17-11-10-16-26(25)27/h4-17,21-22,28-31,37H,3,18-20,36H2,1-2H3,(H,38,41)(H,39,43)(H,40,42)(H,44,45) |
| InChIKey | JZNXWXBGUAKVFJ-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ile-Phe-Phe-Trp (CHEBI:183167) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[[2-[[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]amino]-3-phenylpropanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16653339 | ChemSpider |