EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C28H38N8O5 |
| Net Charge | 0 |
| Average Mass | 566.663 |
| Monoisotopic Mass | 566.29652 |
| SMILES | NCCCCC(NC(=O)C(N)Cc1cncn1)C(=O)NC(Cc1cnc2ccccc12)C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C28H38N8O5/c29-10-4-3-8-22(34-25(37)20(30)13-18-15-31-16-33-18)26(38)35-23(27(39)36-11-5-9-24(36)28(40)41)12-17-14-32-21-7-2-1-6-19(17)21/h1-2,6-7,14-16,20,22-24,32H,3-5,8-13,29-30H2,(H,31,33)(H,34,37)(H,35,38)(H,40,41) |
| InChIKey | AASNLFZFELCSQY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| His-Lys-Trp-Pro (CHEBI:183152) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 1-[2-[[6-amino-2-[[2-amino-3-(1H-imidazol-5-yl)propanoyl]amino]hexanoyl]amino]-3-(1H-indol-3-yl)propanoyl]pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 16644632 | ChemSpider |