EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C39H44N10O5 |
| Net Charge | 0 |
| Average Mass | 732.846 |
| Monoisotopic Mass | 732.34961 |
| SMILES | NC(N)=NCCCC(N)C(=O)NC(Cc1cnc2ccccc12)C(=O)NC(Cc1cnc2ccccc12)C(=O)NC(Cc1cnc2ccccc12)C(=O)O |
| InChI | InChI=1S/C39H44N10O5/c40-28(11-7-15-43-39(41)42)35(50)47-32(16-22-19-44-29-12-4-1-8-25(22)29)36(51)48-33(17-23-20-45-30-13-5-2-9-26(23)30)37(52)49-34(38(53)54)18-24-21-46-31-14-6-3-10-27(24)31/h1-6,8-10,12-14,19-21,28,32-34,44-46H,7,11,15-18,40H2,(H,47,50)(H,48,51)(H,49,52)(H,53,54)(H4,41,42,43) |
| InChIKey | DBLXNGHFOJZXMS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Arg-Trp-Trp-Trp (CHEBI:183150) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[[2-[[2-[[2-amino-5-(diaminomethylideneamino)pentanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoyl]amino]-3-(1H-indol-3-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16591195 | ChemSpider |