EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H6N2O8 |
| Net Charge | 0 |
| Average Mass | 330.208 |
| Monoisotopic Mass | 330.01242 |
| SMILES | O=C(O)c1cc(C(=O)O)c2c(n1)C(=O)C(=O)c1cc(C(=O)O)nc1-2 |
| InChI | InChI=1S/C14H6N2O8/c17-10-4-2-6(14(23)24)15-8(4)7-3(12(19)20)1-5(13(21)22)16-9(7)11(10)18/h1-2,15H,(H,19,20)(H,21,22)(H,23,24) |
| InChIKey | MMXZSJMASHPLLR-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Chemical Roles: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Roles: | water-soluble vitamin (role) Any vitamin that dissolves in water and readily absorbed into tissues for immediate use. Unlike the fat-soluble vitamins, they are not stored in the body and need to be replenished regularly in the diet and will rarely accumulate to toxic levels since they are quickly excreted from the body via urine. cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). cofactor An organic molecule or ion (usually a metal ion) that is required by an enzyme for its activity. It may be attached either loosely (coenzyme) or tightly (prosthetic group). |
| Application: | anti-inflammatory agent Any compound that has anti-inflammatory effects. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| pyrroloquinoline quinone (CHEBI:18315) has role anti-inflammatory agent (CHEBI:67079) |
| pyrroloquinoline quinone (CHEBI:18315) has role antioxidant (CHEBI:22586) |
| pyrroloquinoline quinone (CHEBI:18315) has role cofactor (CHEBI:23357) |
| pyrroloquinoline quinone (CHEBI:18315) has role water-soluble vitamin (role) (CHEBI:27314) |
| pyrroloquinoline quinone (CHEBI:18315) is a orthoquinones (CHEBI:25622) |
| pyrroloquinoline quinone (CHEBI:18315) is a pyrroloquinoline cofactor (CHEBI:26461) |
| pyrroloquinoline quinone (CHEBI:18315) is a tricarboxylic acid (CHEBI:27093) |
| pyrroloquinoline quinone (CHEBI:18315) is conjugate acid of pyrroloquinoline quinone(3−) (CHEBI:58442) |
| Incoming Relation(s) |
| pyrroloquinoline quinone(3−) (CHEBI:58442) is conjugate base of pyrroloquinoline quinone (CHEBI:18315) |
| IUPAC Name |
|---|
| 4,5-dioxo-4,5-dihydro-1H-pyrrolo[2,3-f]quinoline-2,7,9-tricarboxylic acid |
| Synonyms | Source |
|---|---|
| PQQ | KEGG COMPOUND |
| Pyrrolo-quinoline quinone | KEGG COMPOUND |
| Pyrroloquinoline-quinone | KEGG COMPOUND |
| Pyrroloquinoline quinone | KEGG COMPOUND |
| PYRROLOQUINOLINE QUINONE | PDBeChem |
| methoxatin | ChemIDplus |
| Manual Xrefs | Databases |
|---|---|
| C00113 | KEGG COMPOUND |
| PQQ | PDBeChem |
| AA0283 | RESID |
| DB03205 | DrugBank |
| Pyrroloquinoline_quinone | Wikipedia |
| 997 | ChemSpider |
| FDB012848 | FooDB |
| C00053736 | KNApSAcK |
| HMDB0013636 | HMDB |
| Registry Numbers | Sources |
|---|---|
| Gmelin:56633 | Gmelin |
| Beilstein:3596812 | Beilstein |
| CAS:72909-34-3 | KEGG COMPOUND |
| CAS:72909-34-3 | ChemIDplus |
| Citations |
|---|