EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H27N5O7 |
| Net Charge | 0 |
| Average Mass | 449.464 |
| Monoisotopic Mass | 449.19105 |
| SMILES | CC(N)C(=O)NC(Cc1cnc2ccccc12)C(=O)NC(CO)C(=O)NC(CO)C(=O)O |
| InChI | InChI=1S/C20H27N5O7/c1-10(21)17(28)23-14(6-11-7-22-13-5-3-2-4-12(11)13)18(29)24-15(8-26)19(30)25-16(9-27)20(31)32/h2-5,7,10,14-16,22,26-27H,6,8-9,21H2,1H3,(H,23,28)(H,24,29)(H,25,30)(H,31,32) |
| InChIKey | MRXZVZVKYZELRU-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ala-Trp-Ser-Ser (CHEBI:183138) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[[2-[[2-(2-aminopropanoylamino)-3-(1H-indol-3-yl)propanoyl]amino]-3-hydroxypropanoyl]amino]-3-hydroxypropanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16583186 | ChemSpider |