EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H30N8O8 |
| Net Charge | 0 |
| Average Mass | 570.563 |
| Monoisotopic Mass | 570.21866 |
| SMILES | NC(=O)CC(N)C(=O)NC(Cc1cnc2ccccc12)C(=O)NC(CC(=O)O)C(=O)NC(Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C25H30N8O8/c26-15(7-20(27)34)22(37)31-17(5-12-9-29-16-4-2-1-3-14(12)16)23(38)32-18(8-21(35)36)24(39)33-19(25(40)41)6-13-10-28-11-30-13/h1-4,9-11,15,17-19,29H,5-8,26H2,(H2,27,34)(H,28,30)(H,31,37)(H,32,38)(H,33,39)(H,35,36)(H,40,41) |
| InChIKey | VTPSCIXGVDDGMB-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Trp-Asp-His (CHEBI:183129) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 4-[[1-carboxy-2-(1H-imidazol-5-yl)ethyl]amino]-3-[[2-[(2,4-diamino-4-oxobutanoyl)amino]-3-(1H-indol-3-yl)propanoyl]amino]-4-oxobutanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16598899 | ChemSpider |