EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C25H36N4O5 |
| Net Charge | 0 |
| Average Mass | 472.586 |
| Monoisotopic Mass | 472.26857 |
| SMILES | CCC(C)C(N)C(=O)NC(Cc1ccccc1)C(=O)N1CCCC1C(=O)N1CCCC1C(=O)O |
| InChI | InChI=1S/C25H36N4O5/c1-3-16(2)21(26)22(30)27-18(15-17-9-5-4-6-10-17)23(31)28-13-7-11-19(28)24(32)29-14-8-12-20(29)25(33)34/h4-6,9-10,16,18-21H,3,7-8,11-15,26H2,1-2H3,(H,27,30)(H,33,34) |
| InChIKey | QQFSKBMCAKWHLG-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Ile-Phe-Pro-Pro (CHEBI:183124) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 1-[1-[2-[(2-amino-3-methylpentanoyl)amino]-3-phenylpropanoyl]pyrrolidine-2-carbonyl]pyrrolidine-2-carboxylic acid |
| Manual Xrefs | Databases |
|---|---|
| 16653356 | ChemSpider |