EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H24N8O7 |
| Net Charge | 0 |
| Average Mass | 440.417 |
| Monoisotopic Mass | 440.17680 |
| SMILES | NC(=O)CC(N)C(=O)NC(CC(N)=O)C(=O)NCC(=O)NC(Cc1cncn1)C(=O)O |
| InChI | InChI=1S/C16H24N8O7/c17-8(2-11(18)25)14(28)24-9(3-12(19)26)15(29)21-5-13(27)23-10(16(30)31)1-7-4-20-6-22-7/h4,6,8-10H,1-3,5,17H2,(H2,18,25)(H2,19,26)(H,20,22)(H,21,29)(H,23,27)(H,24,28)(H,30,31) |
| InChIKey | LDSFSKFATNBTBV-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Trypanosoma brucei (ncbitaxon:5691) | cell culture (BTO:0000214) | MetaboLights (MTBLS2559) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Asn-Asn-Gly-His (CHEBI:183123) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[[2-[[4-amino-2-[(2,4-diamino-4-oxobutanoyl)amino]-4-oxobutanoyl]amino]acetyl]amino]-3-(1H-imidazol-5-yl)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16592982 | ChemSpider |