EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
CHEBI:183083 - indirubin
| Formula | C16H10N2O2 |
| Net Charge | 0 |
| Average Mass | 262.268 |
| Monoisotopic Mass | 262.07423 |
| SMILES | O=C1Nc2ccccc2C1=C1Nc2ccccc2C1=O |
| InChI | InChI=1S/C16H10N2O2/c19-15-10-6-2-4-8-12(10)17-14(15)13-9-5-1-3-7-11(9)18-16(13)20/h1-8,17H,(H,18,20) |
| InChIKey | CRDNMYFJWFXOCH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. |
| Applications: | antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. antipsoriatic A drug used to treat psoriasis. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. anti-inflammatory agent Any compound that has anti-inflammatory effects. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indirubin (CHEBI:183083) has role angiogenesis inhibitor (CHEBI:48422) |
| indirubin (CHEBI:183083) has role anti-inflammatory agent (CHEBI:67079) |
| indirubin (CHEBI:183083) has role antineoplastic agent (CHEBI:35610) |
| indirubin (CHEBI:183083) has role antipsoriatic (CHEBI:50748) |
| indirubin (CHEBI:183083) has role apoptosis inducer (CHEBI:68495) |
| indirubin (CHEBI:183083) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| indirubin (CHEBI:183083) has role autophagy inducer (CHEBI:138880) |
| indirubin (CHEBI:183083) has role geroprotector (CHEBI:176497) |
| indirubin (CHEBI:183083) has role plant metabolite (CHEBI:76924) |
| indirubin (CHEBI:183083) has role Wnt signalling inhibitor (CHEBI:78031) |
| indirubin (CHEBI:183083) is a bisindole (CHEBI:51877) |
| indirubin (CHEBI:183083) is a indolones (CHEBI:24829) |
| IUPAC Name |
|---|
| 3-(3-oxo-1,3-dihydro-2H-indol-2-ylidene)-1,3-dihydro-2H-indol-2-one |
| Synonyms | Source |
|---|---|
| C.I. 73200 | ChemIDplus |
| couroupitine B | ChemIDplus |
| indigo red | ChemIDplus |
| indigopurpurin | ChemIDplus |
| 3-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,3-dihydro-2H-indol-2-one | ChemIDplus |
| [Δ2,3'-biindoline]-2',3-dione | ChemIDplus |
| Citations |
|---|