EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H10N2O2 |
| Net Charge | 0 |
| Average Mass | 262.268 |
| Monoisotopic Mass | 262.07423 |
| SMILES | O=C1Nc2ccccc2C1=C1Nc2ccccc2C1=O |
| InChI | InChI=1S/C16H10N2O2/c19-15-10-6-2-4-8-12(10)17-14(15)13-9-5-1-3-7-11(9)18-16(13)20/h1-8,17H,(H,18,20) |
| InChIKey | CRDNMYFJWFXOCH-UHFFFAOYSA-N |
| Wikipedia |
|---|
| Roles Classification |
|---|
| Biological Roles: | Wnt signalling inhibitor A substance that inhibits any of the Wnt signalling pathway, a group of signal transduction pathways made of proteins that pass signals from outside of a cell through cell surface receptors to the inside of the cell. autophagy inducer Any compound that induces the process of autophagy (the self-digestion of one or more components of a cell through the action of enzymes originating within the same cell). plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. aryl hydrocarbon receptor agonist An agonist that binds to and activates aryl hydrocarbon receptors (AhRs). apoptosis inducer Any substance that induces the process of apoptosis (programmed cell death) in multi-celled organisms. |
| Applications: | anti-inflammatory agent Any compound that has anti-inflammatory effects. angiogenesis inhibitor An agent and endogenous substances that antagonize or inhibit the development of new blood vessels. antineoplastic agent A substance that inhibits or prevents the proliferation of neoplasms. geroprotector Any compound that supports healthy aging, slows the biological aging process, or extends lifespan. antipsoriatic A drug used to treat psoriasis. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| indirubin (CHEBI:183083) has role angiogenesis inhibitor (CHEBI:48422) |
| indirubin (CHEBI:183083) has role anti-inflammatory agent (CHEBI:67079) |
| indirubin (CHEBI:183083) has role antineoplastic agent (CHEBI:35610) |
| indirubin (CHEBI:183083) has role antipsoriatic (CHEBI:50748) |
| indirubin (CHEBI:183083) has role apoptosis inducer (CHEBI:68495) |
| indirubin (CHEBI:183083) has role aryl hydrocarbon receptor agonist (CHEBI:72768) |
| indirubin (CHEBI:183083) has role autophagy inducer (CHEBI:138880) |
| indirubin (CHEBI:183083) has role geroprotector (CHEBI:176497) |
| indirubin (CHEBI:183083) has role plant metabolite (CHEBI:76924) |
| indirubin (CHEBI:183083) has role Wnt signalling inhibitor (CHEBI:78031) |
| indirubin (CHEBI:183083) is a bisindole (CHEBI:51877) |
| indirubin (CHEBI:183083) is a indolones (CHEBI:24829) |
| IUPAC Name |
|---|
| 3-(3-oxo-1,3-dihydro-2H-indol-2-ylidene)-1,3-dihydro-2H-indol-2-one |
| Synonyms | Source |
|---|---|
| 3-(1,3-dihydro-3-oxo-2H-indol-2-ylidene)-1,3-dihydro-2H-indol-2-one | ChemIDplus |
| 3-(3-oxo-1H-indol-2-ylidene)-1H-indol-2-one | ChEBI |
| C.I. 73200 | ChemIDplus |
| couroupitine B | ChemIDplus |
| indigopurpurin | ChemIDplus |
| indigo red | ChemIDplus |
| Citations |
|---|