EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C27H44O5 |
| Net Charge | 0 |
| Average Mass | 448.644 |
| Monoisotopic Mass | 448.31887 |
| SMILES | [H][C@@]12CC[C@]([H])([C@H](C)C[C@H](O)CC(C)C)[C@@]1(C)CCC/C2=C\C1OOCC2=C1C[C@@H](O)C[C@@H]2O |
| InChI | InChI=1S/C27H44O5/c1-16(2)10-19(28)11-17(3)23-7-8-24-18(6-5-9-27(23,24)4)12-26-21-13-20(29)14-25(30)22(21)15-31-32-26/h12,16-17,19-20,23-26,28-30H,5-11,13-15H2,1-4H3/b18-12+/t17-,19-,20-,23-,24+,25+,26?,27-/m1/s1 |
| InChIKey | DKYWDJRYWSGSCA-HDINTAEKSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | Esophagus (BTO:0000959) | MetaboLights (MTBLS3014) |
| Roles Classification |
|---|
| Biological Role: | fat-soluble vitamin (role) Any vitamin that dissolves in fats and are stored in body tissues. Unlike the water-soluble vitamins, they are stored in the body for long periods of time and generally pose a greater risk for toxicity when consumed in excess. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (24R)-6,19-epidioxy-1,24-dihydroxy-6,19-dihydrovitamin D3 / (24R)-6,19-epidioxy-1,24-di hydroxy-6,19-dihydrocholecalciferol (CHEBI:183032) is a vitamin D (CHEBI:27300) |
| IUPAC Name |
|---|
| (5S,7R)-1-[(E)-[(1R,3aS,7aR)-1-[(2R,4R)-4-hydroxy-6-methylheptan-2-yl]-7a-methyl-2,3,3a,5,6,7-hexahydro-1H-inden-4-ylidene]methyl]-1,4,5,6,7,8-hexahydro-2,3-benzodioxine-5,7-diol |
| Manual Xrefs | Databases |
|---|---|
| 7826391 | ChemSpider |
| LMST03020301 | LIPID MAPS |