EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C16H19NO8 |
| Net Charge | 0 |
| Average Mass | 353.327 |
| Monoisotopic Mass | 353.11107 |
| SMILES | CC(=O)OCC1OC(OC(C#N)c2cccc(O)c2)C(O)C(O)C1O |
| InChI | InChI=1S/C16H19NO8/c1-8(18)23-7-12-13(20)14(21)15(22)16(25-12)24-11(6-17)9-3-2-4-10(19)5-9/h2-5,11-16,19-22H,7H2,1H3 |
| InChIKey | NIVXKMKLZUXGSY-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Rattus norvegicus (ncbitaxon:10116) | Esophagus (BTO:0000959) | MetaboLights (MTBLS3014) |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 6''-O-Acetylholocalin (CHEBI:183025) is a cyanogenic glycoside (CHEBI:23436) |
| IUPAC Name |
|---|
| [6-[cyano-(3-hydroxyphenyl)methoxy]-3,4,5-trihydroxyoxan-2-yl]methyl acetate |
| Manual Xrefs | Databases |
|---|---|
| HMDB0036331 | HMDB |