EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C23H36N8O6 |
| Net Charge | 0 |
| Average Mass | 520.591 |
| Monoisotopic Mass | 520.27578 |
| SMILES | CC(NC(=O)C(CCC(N)=O)NC(=O)C(N)Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| InChI | InChI=1S/C23H36N8O6/c1-13(19(33)31-17(22(36)37)8-5-11-28-23(26)27)29-21(35)16(9-10-18(25)32)30-20(34)15(24)12-14-6-3-2-4-7-14/h2-4,6-7,13,15-17H,5,8-12,24H2,1H3,(H2,25,32)(H,29,35)(H,30,34)(H,31,33)(H,36,37)(H4,26,27,28) |
| InChIKey | UNZNFYLFNRNPBS-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cucumis melo (ncbitaxon:3656) | seed (BTO:0001226) | MetaboLights (MTBLS2993) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Phe-Gln-Ala-Arg (CHEBI:182978) is a tetrapeptide (CHEBI:48030) |
| IUPAC Name |
|---|
| 2-[2-[[5-amino-2-[(2-amino-3-phenylpropanoyl)amino]-5-oxopentanoyl]amino]propanoylamino]-5-(diaminomethylideneamino)pentanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 16682169 | ChemSpider |