EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C36H56O11 |
| Net Charge | 0 |
| Average Mass | 664.833 |
| Monoisotopic Mass | 664.38226 |
| SMILES | C=C(C)CCC(=O)C(C)(O)C1[C@H](O)C[C@@]2(C)C3CC=C4C(C[C@H](O)[C@@H](O[C@@H]5O[C@H](CO)[C@@H](O)[C@H](O)[C@H]5O)C4(C)C)[C@]3(C)C(=O)C[C@]12C |
| InChI | InChI=1S/C36H56O11/c1-17(2)9-12-24(40)36(8,45)29-21(39)14-33(5)23-11-10-18-19(35(23,7)25(41)15-34(29,33)6)13-20(38)30(32(18,3)4)47-31-28(44)27(43)26(42)22(16-37)46-31/h10,19-23,26-31,37-39,42-45H,1,9,11-16H2,2-8H3/t19?,20-,21+,22+,23?,26+,27-,28+,29?,30+,31-,33-,34+,35-,36?/m0/s1 |
| InChIKey | KISJFUMXCJBLJV-NNNWQWOPSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Cucumis melo (ncbitaxon:3656) | seed (BTO:0001226) | MetaboLights (MTBLS2993) |
| Roles Classification |
|---|
| Biological Role: | allelochemical A class of secondary metabolites developed by many plants to influence the behaviour, growth or survival of herbivores, and thus acting as a defence against herbivory. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| NCGC00385187-01 (CHEBI:182972) is a cucurbitacin (CHEBI:16219) |
| IUPAC Name |
|---|
| (2S,3S,9R,13R,14S,16R)-2,16-dihydroxy-17-[(2R)-2-hydroxy-6-methyl-3-oxohept-6-en-2-yl]-4,4,9,13,14-pentamethyl-3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-1,2,3,7,8,10,12,15,16,17-decahydrocyclopenta[a]phenanthren-11-one |
| Manual Xrefs | Databases |
|---|---|
| 29814301 | ChemSpider |