EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H26N2O2 |
| Net Charge | 0 |
| Average Mass | 326.440 |
| Monoisotopic Mass | 326.19943 |
| SMILES | [H][C@]12C[C@@]34c5ccccc5N(C)[C@@]3([H])C3C[C@]([H])(C1C4O)[C@H](CC)[C@@H](O)N32 |
| InChI | InChI=1S/C20H26N2O2/c1-3-10-11-8-14-17-20(12-6-4-5-7-13(12)21(17)2)9-15(16(11)18(20)23)22(14)19(10)24/h4-7,10-11,14-19,23-24H,3,8-9H2,1-2H3/t10-,11-,14?,15-,16?,17-,18?,19+,20+/m0/s1 |
| InChIKey | CJDRUOGAGYHKKD-VXARLCFTSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,9R,12R,13S,14R,16S,18R)-13-Ethyl-8-methyl-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol (CHEBI:182962) is a indole alkaloid (CHEBI:38958) |
| IUPAC Name |
|---|
| (1R,9R,12R,13S,14R,16S,18R)-13-ethyl-8-methyl-8,15-diazahexacyclo[14.2.1.01,9.02,7.010,15.012,17]nonadeca-2,4,6-triene-14,18-diol |