EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H33N3 |
| Net Charge | 0 |
| Average Mass | 315.505 |
| Monoisotopic Mass | 315.26745 |
| SMILES | [H][C@@]12CCCN3[C@@]1([H])[C@]1(CN4CCCC[C@]4([H])[C@]([H])(C2)C1)[C@]1([H])CCC[C@@]3([H])N1 |
| InChI | InChI=1S/C20H33N3/c1-2-9-22-13-20-12-15(16(22)6-1)11-14-5-4-10-23(19(14)20)18-8-3-7-17(20)21-18/h14-19,21H,1-13H2/t14-,15+,16+,17-,18-,19+,20+/m0/s1 |
| InChIKey | MRLGBUWOAFGOBH-AKIVOZEDSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (1R,2S,6S,11S,13R,14R,21R)-7,19,23-Triazahexacyclo[9.9.1.11,13.12,6.07,21.014,19]tricosane (CHEBI:182950) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (1R,2S,6S,11S,13R,14R,21R)-7,19,23-triazahexacyclo[9.9.1.11,13.12,6.07,21.014,19]tricosane |
| Manual Xrefs | Databases |
|---|---|
| C10778 | KEGG COMPOUND |