EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C18H20N2 |
| Net Charge | 0 |
| Average Mass | 264.372 |
| Monoisotopic Mass | 264.16265 |
| SMILES | [H][C@@]12CCN(C/C1=C/C)Cc1c(nc3ccccc13)C2=C |
| InChI | InChI=1S/C18H20N2/c1-3-13-10-20-9-8-14(13)12(2)18-16(11-20)15-6-4-5-7-17(15)19-18/h3-7,14,19H,2,8-11H2,1H3/b13-3-/t14-/m0/s1 |
| InChIKey | LCVACABZTLIWCE-SUSILRQXSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (13R,14E)-14-Ethylidene-12-methylidene-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4,6,8-tetraene (CHEBI:182901) is a alkaloid (CHEBI:22315) |
| IUPAC Name |
|---|
| (13R,14E)-14-ethylidene-12-methylidene-1,10-diazatetracyclo[11.2.2.03,11.04,9]heptadeca-3(11),4,6,8-tetraene |
| Manual Xrefs | Databases |
|---|---|
| 5288661 | ChemSpider |