EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C9H13NO2 |
| Net Charge | 0 |
| Average Mass | 167.208 |
| Monoisotopic Mass | 167.09463 |
| SMILES | Cc1c(CCN)ccc(O)c1O |
| InChI | InChI=1S/C9H13NO2/c1-6-7(4-5-10)2-3-8(11)9(6)12/h2-3,11-12H,4-5,10H2,1H3 |
| InChIKey | NSEVRAZZUOXAHQ-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). |
| Biological Role: |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 2-Methyldopamine (CHEBI:182772) is a catecholamine (CHEBI:33567) |
| IUPAC Name |
|---|
| 4-(2-aminoethyl)-3-methylbenzene-1,2-diol |
| Manual Xrefs | Databases |
|---|---|
| 61670 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:53622-73-4 | ChemIDplus |