EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H12NO4.Na |
| Net Charge | 0 |
| Average Mass | 185.155 |
| Monoisotopic Mass | 185.06640 |
| SMILES | O=C([O-])CN(CCO)CCO.[Na+] |
| InChI | InChI=1S/C6H13NO4.Na/c8-3-1-7(2-4-9)5-6(10)11;/h8-9H,1-5H2,(H,10,11);/q;+1/p-1 |
| InChIKey | MFBDBXAVPLFMNJ-UHFFFAOYSA-M |
| Roles Classification |
|---|
| Chemical Roles: | Bronsted base A molecular entity capable of accepting a hydron from a donor (Brønsted acid). Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| N,N-Bis(2-hydroxyethyl)glycine sodium salt (CHEBI:182771) is a α-amino acid (CHEBI:33704) |
| IUPAC Name |
|---|
| sodium;2-[bis(2-hydroxyethyl)amino]acetate |