EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O8 |
| Net Charge | 0 |
| Average Mass | 328.317 |
| Monoisotopic Mass | 328.11582 |
| SMILES | C[C@@H]1C[C@@H](O)[C@@]2(O)[C@@]13C[C@@H](OC(=O)[C@@H]3O)[C@](C)(O)[C@@]21COC1=O |
| InChI | InChI=1S/C15H20O8/c1-6-3-7(16)15(21)13(6)4-8(23-10(18)9(13)17)12(2,20)14(15)5-22-11(14)19/h6-9,16-17,20-21H,3-5H2,1-2H3/t6-,7-,8-,9+,12+,13+,14+,15-/m1/s1 |
| InChIKey | GEVWHIDSUOMVRI-QWNPAUMXSA-N |
| Wikipedia |
|---|
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Illicium anisatum (ncbitaxon:12479) | seed (BTO:0001226) | PubMed (6974321) | |
| Illicium fargesii (ncbitaxon:124774) | pericarp (BTO:0001017) | PubMed (18670129) | |
| Illicium oligandrum (ncbitaxon:145286) | pericarp (BTO:0001017) | PubMed (19159273) | |
| Illicium religiosum (IPNI:554536-1) | seed (BTO:0001226) | DOI (10.1016/S0040-4039(01)89037-7) |
| Roles Classification |
|---|
| Biological Roles: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. neurotoxin A poison that interferes with the functions of the nervous system. |
| Applications: | phytogenic insecticide An insecticide compound naturally occurring in plants. GABA antagonist A compound that inhibits the action of γ-aminobutyric acid. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| anisatin (CHEBI:182764) has role GABA antagonist (CHEBI:65259) |
| anisatin (CHEBI:182764) has role neurotoxin (CHEBI:50910) |
| anisatin (CHEBI:182764) has role phytogenic insecticide (CHEBI:22917) |
| anisatin (CHEBI:182764) has role plant metabolite (CHEBI:76924) |
| anisatin (CHEBI:182764) is a bridged compound (CHEBI:35990) |
| anisatin (CHEBI:182764) is a organic heterotetracyclic compound (CHEBI:38163) |
| anisatin (CHEBI:182764) is a secondary alcohol (CHEBI:35681) |
| anisatin (CHEBI:182764) is a sesquiterpene lactone (CHEBI:37667) |
| anisatin (CHEBI:182764) is a spiro compound (CHEBI:33599) |
| anisatin (CHEBI:182764) is a tertiary alcohol (CHEBI:26878) |
| anisatin (CHEBI:182764) is a tetrol (CHEBI:33573) |
| IUPAC Name |
|---|
| (1R,3'S,4R,5R,6aR,7R,9R,9aS)-1,5,6a,7-tetrahydroxy-5,9-dimethylhexahydrospiro[4,9a-methanocyclopenta[d]oxocine-6,3'-oxetane]-2,2'(1H)-dione |
| Synonyms | Source |
|---|---|
| Anisatin | KEGG COMPOUND |
| (−)-anisatin | ChEBI |
| (1R,3'S,4R,5R,6aR,7R,9R,9aS)-hexahydro-1,5,6a,7-tetrahydroxy-5,9-dimethylspiro[4H-4,9a-methanocyclopent[d]oxocin-6(2H),3'-oxetane]-2,2'-dione | ChEBI |
| Manual Xrefs | Databases |
|---|---|
| C09294 | KEGG COMPOUND |
| C00003212 | KNApSAcK |
| FDB005800 | FooDB |
| HMDB0302686 | HMDB |
| Anisatin | Wikipedia |
| Registry Numbers | Sources |
|---|---|
| CAS:5230-87-5 | KEGG COMPOUND |
| Citations |
|---|