EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C14H17NO5 |
| Net Charge | 0 |
| Average Mass | 279.292 |
| Monoisotopic Mass | 279.11067 |
| SMILES | CCc1cccc(C)c1N(C(=O)C(=O)O)C(C)C(=O)O |
| InChI | InChI=1S/C14H17NO5/c1-4-10-7-5-6-8(2)11(10)15(9(3)13(17)18)12(16)14(19)20/h5-7,9H,4H2,1-3H3,(H,17,18)(H,19,20) |
| InChIKey | IMFSUYMDPTXKCC-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Metolachlor CGA 357704 (CHEBI:182739) is a N-acyl-amino acid (CHEBI:51569) |
| IUPAC Name |
|---|
| 2-(2-ethyl-6-methyl-N-oxaloanilino)propanoic acid |
| Manual Xrefs | Databases |
|---|---|
| 95609009 | ChemSpider |