EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C17H21N3 |
| Net Charge | 0 |
| Average Mass | 267.376 |
| Monoisotopic Mass | 267.17355 |
| SMILES | CNCCCCc1cnc(C)c2nc3ccccc3c12 |
| InChI | InChI=1S/C17H21N3/c1-12-17-16(14-8-3-4-9-15(14)20-17)13(11-19-12)7-5-6-10-18-2/h3-4,8-9,11,18,20H,5-7,10H2,1-2H3 |
| InChIKey | OMGIBPZQATWNBX-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Brevicarine (CHEBI:182703) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| N-methyl-4-(1-methyl-9H-pyrido[3,4-b]indol-4-yl)butan-1-amine |
| Manual Xrefs | Databases |
|---|---|
| 4590257 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:25978-39-6 | ChemIDplus |