EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C31H52O3 |
| Net Charge | 0 |
| Average Mass | 472.754 |
| Monoisotopic Mass | 472.39165 |
| SMILES | CC(=O)Oc1c(C)c(C)c2c(c1C)CCC(C)(CCCC(C)CCCC(C)CCCC(C)C)O2 |
| InChI | InChI=1S/C31H52O3/c1-21(2)13-10-14-22(3)15-11-16-23(4)17-12-19-31(9)20-18-28-26(7)29(33-27(8)32)24(5)25(6)30(28)34-31/h21-23H,10-20H2,1-9H3 |
| InChIKey | ZAKOWWREFLAJOT-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Mus musculus (ncbitaxon:10090) | small intestine (BTO:0000651) | MetaboLights (MTBLS3486) | Strain: C57BL/6 Mouse [THESAURUS.OWL#C14424] |
| Nippostrongylus brasiliensis (ncbitaxon:27835) | Whole Organism (NCIT:C13413) | MetaboLights (MTBLS3486) |
| Roles Classification |
|---|
| Chemical Role: | antioxidant A substance that opposes oxidation or inhibits reactions brought about by dioxygen or peroxides. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| DL-alpha-Tocopherol acetate (CHEBI:182695) is a tocol (CHEBI:39437) |
| IUPAC Name |
|---|
| [2,5,7,8-tetramethyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-yl] acetate |
| Manual Xrefs | Databases |
|---|---|
| 2033 | ChemSpider |
| D01735 | KEGG DRUG |
| HMDB0034227 | HMDB |
| Registry Numbers | Sources |
|---|---|
| CAS:52225-20-4 | ChemIDplus |