EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C20H25N3O |
| Net Charge | 0 |
| Average Mass | 323.440 |
| Monoisotopic Mass | 323.19976 |
| SMILES | CCN(CC)C(=O)C1C=C2c3cccc4ncc(c34)CC2N(C)C1 |
| InChI | InChI=1S/C20H25N3O/c1-4-23(5-2)20(24)14-9-16-15-7-6-8-17-19(15)13(11-21-17)10-18(16)22(3)12-14/h6-9,11,14,18,21H,4-5,10,12H2,1-3H3 |
| InChIKey | VAYOSLLFUXYJDT-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| D-Lysergic acid N,N-diethylamide (CHEBI:182684) is a ergoline alkaloid (CHEBI:60529) |
| IUPAC Name |
|---|
| N,N-diethyl-7-methyl-6,6a,8,9-tetrahydro-4H-indolo[4,3-g]quinoline-9-carboxamide |