EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C6H6O4 |
| Net Charge | 0 |
| Average Mass | 142.110 |
| Monoisotopic Mass | 142.02661 |
| SMILES | O=C(O)CC1=CCC(=O)O1 |
| InChI | InChI=1S/C6H6O4/c7-5(8)3-4-1-2-6(9)10-4/h1H,2-3H2,(H,7,8) |
| InChIKey | ZPEHSARSWGDCEX-UHFFFAOYSA-N |
| Species of Metabolite | Component | Source | Comments |
|---|---|---|---|
| Burkholderia cepacia (ncbitaxon:292) | - | PubMed (7684040) |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| Biological Role: | bacterial metabolite Any prokaryotic metabolite produced during a metabolic reaction in bacteria. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 5-oxo-4,5-dihydro-2-furylacetic acid (CHEBI:18267) has role bacterial metabolite (CHEBI:76969) |
| 5-oxo-4,5-dihydro-2-furylacetic acid (CHEBI:18267) is a 5-oxo-2-furylacetic acid (CHEBI:23730) |
| 5-oxo-4,5-dihydro-2-furylacetic acid (CHEBI:18267) is conjugate acid of 5-oxo-4,5-dihydro-2-furylacetate (CHEBI:58425) |
| Incoming Relation(s) |
| 5-oxo-4,5-dihydro-2-furylacetate (CHEBI:58425) is conjugate base of 5-oxo-4,5-dihydro-2-furylacetic acid (CHEBI:18267) |
| IUPAC Name |
|---|
| (5-oxo-4,5-dihydrofuran-2-yl)acetic acid |
| Synonyms | Source |
|---|---|
| 2-Oxo-2,3-dihydrofuran-5-acetate | KEGG COMPOUND |
| 3-oxoadipate enol-lactone | ChEBI |
| 3-Oxoadipate enol-lactone | KEGG COMPOUND |
| 4,5-Dihydro-5-oxofuran-2-acetate | KEGG COMPOUND |
| 5-oxo-4,5-dihydrofuran-2-acetate | ChEBI |
| 5-Oxo-4,5-dihydrofuran-2-acetate | KEGG COMPOUND |
| Manual Xrefs | Databases |
|---|---|
| 3-OXOADIPATE-ENOL-LACTONE | MetaCyc |
| C00007489 | KNApSAcK |
| C03586 | KEGG COMPOUND |
| C03586 | KEGG COMPOUND |
| Registry Numbers | Sources |
|---|---|
| Reaxys:120576 | Reaxys |
| Citations |
|---|