EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C19H20O3 |
| Net Charge | 0 |
| Average Mass | 296.366 |
| Monoisotopic Mass | 296.14124 |
| SMILES | O=C(/C=C/CCc1ccc(O)cc1)CCc1ccc(O)cc1 |
| InChI | InChI=1S/C19H20O3/c20-17(10-7-16-8-13-19(22)14-9-16)4-2-1-3-15-5-11-18(21)12-6-15/h2,4-6,8-9,11-14,21-22H,1,3,7,10H2/b4-2+ |
| InChIKey | GIKJADRKBZHVCY-DUXPYHPUSA-N |
| Roles Classification |
|---|
| Biological Role: | plant metabolite Any eukaryotic metabolite produced during a metabolic reaction in plants, the kingdom that include flowering plants, conifers and other gymnosperms. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| (E)-1,7-Bis(4-hydroxyphenyl)hept-4-en-3-one (CHEBI:182667) is a diarylheptanoid (CHEBI:78802) |
| IUPAC Name |
|---|
| (E)-1,7-bis(4-hydroxyphenyl)hept-4-en-3-one |
| Manual Xrefs | Databases |
|---|---|
| HMDB0138206 | HMDB |
| 22912888 | ChemSpider |