EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C11H13NO3 |
| Net Charge | 0 |
| Average Mass | 207.229 |
| Monoisotopic Mass | 207.08954 |
| SMILES | CNC(C)C(=O)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C11H13NO3/c1-7(12-2)11(13)8-3-4-9-10(5-8)15-6-14-9/h3-5,7,12H,6H2,1-2H3 |
| InChIKey | VKEQBMCRQDSRET-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | antidepressant Antidepressants are mood-stimulating drugs used primarily in the treatment of affective disorders and related conditions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methylone (CHEBI:182618) has role antidepressant (CHEBI:35469) |
| Methylone (CHEBI:182618) is a benzodioxoles (CHEBI:38298) |
| IUPAC Name |
|---|
| 1-(1,3-benzodioxol-5-yl)-2-(methylamino)propan-1-one |
| Synonyms | Source |
|---|---|
| .beta.k-mdma | ChEMBL |
| J899.632F | ChEMBL |
| M1 (psychedelic) | ChEMBL |
| Methylenedioxymethcathinone | ChEMBL |
| Methylone | ChEMBL |
| Registry Numbers | Sources |
|---|---|
| CAS:186028-79-5 | ChemIDplus |
| Citations |
|---|