EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C15H20O10 |
| Net Charge | 0 |
| Average Mass | 360.315 |
| Monoisotopic Mass | 360.10565 |
| SMILES | COc1cc(C(=O)OC2OC(CO)C(O)C(O)C2O)cc(O)c1OC |
| InChI | InChI=1S/C15H20O10/c1-22-8-4-6(3-7(17)13(8)23-2)14(21)25-15-12(20)11(19)10(18)9(5-16)24-15/h3-4,9-12,15-20H,5H2,1-2H3 |
| InChIKey | CXFDTBRNJQYDLK-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Application: | astringent A compound that causes the contraction of body tissues, typically used to reduce bleeding from minor abrasions. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| [3,4,5-Trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-hydroxy-4,5-dimethoxybenzoate (CHEBI:182603) is a tannin (CHEBI:26848) |
| IUPAC Name |
|---|
| [3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl] 3-hydroxy-4,5-dimethoxybenzoate |
| Manual Xrefs | Databases |
|---|---|
| 22370077 | ChemSpider |