EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C13H12N2 |
| Net Charge | 0 |
| Average Mass | 196.253 |
| Monoisotopic Mass | 196.10005 |
| SMILES | CCc1nccc2c1nc1ccccc12 |
| InChI | InChI=1S/C13H12N2/c1-2-11-13-10(7-8-14-11)9-5-3-4-6-12(9)15-13/h3-8,15H,2H2,1H3 |
| InChIKey | YTQRHYCHEIXUIU-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Biological Role: | metabolite Any intermediate or product resulting from metabolism. The term 'metabolite' subsumes the classes commonly known as primary and secondary metabolites. |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1-Ethyl-9H-pyrido[3,4-b]indole (CHEBI:182548) is a harmala alkaloid (CHEBI:61379) |
| IUPAC Name |
|---|
| 1-ethyl-9H-pyrido[3,4-b]indole |
| Manual Xrefs | Databases |
|---|---|
| 4481858 | ChemSpider |
| Registry Numbers | Sources |
|---|---|
| CAS:20127-61-1 | ChemIDplus |