EMBL-EBI | Chemical Biology Resources | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C8H10O4 |
| Net Charge | 0 |
| Average Mass | 170.164 |
| Monoisotopic Mass | 170.05791 |
| SMILES | CC1=CC(O)C(O)(C(=O)O)C=C1 |
| InChI | InChI=1S/C8H10O4/c1-5-2-3-8(12,7(10)11)6(9)4-5/h2-4,6,9,12H,1H3,(H,10,11) |
| InChIKey | KWQSYZVAOWYCNP-UHFFFAOYSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| 1,6-Dihydroxy-4-methylcyclohexa-2,4-diene-1-carboxylic acid (CHEBI:182528) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| 1,6-dihydroxy-4-methylcyclohexa-2,4-diene-1-carboxylic acid |