EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H30NO4 |
| Net Charge | +1 |
| Average Mass | 360.474 |
| Monoisotopic Mass | 360.21693 |
| SMILES | [H][C@]12CC(OC(=O)C(CO)c3ccccc3)C[C@@]([H])([C@H]3O[C@H]31)[N+]2(C)CCCC |
| InChI | InChI=1S/C21H30NO4/c1-3-4-10-22(2)17-11-15(12-18(22)20-19(17)26-20)25-21(24)16(13-23)14-8-6-5-7-9-14/h5-9,15-20,23H,3-4,10-13H2,1-2H3/q+1/t15?,16?,17-,18-,19-,20+,22?/m0/s1 |
| InChIKey | YBCNXCRZPWQOBR-FAQYLHNASA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Scopolamine-N-butyl (CHEBI:182431) is a 3-hydroxy carboxylic acid (CHEBI:61355) |
| IUPAC Name |
|---|
| [(1S,2S,4R,5S)-9-butyl-9-methyl-3-oxa-9-azoniatricyclo[3.3.1.02,4]nonan-7-yl] 3-hydroxy-2-phenylpropanoate |
| Manual Xrefs | Databases |
|---|---|
| 8654 | ChemSpider |