EMBL-EBI | Chemical Biology | ChEBI
Example searches: iron*, InChI=1S/CH4O/c1-2/h2H,1H3, caffeine | Advanced Search
| Formula | C21H20N2O5 |
| Net Charge | 0 |
| Average Mass | 380.400 |
| Monoisotopic Mass | 380.13722 |
| SMILES | [H][C@@]12C[C@]34C=CC(=O)N3CCC3(OC1=O)c1ccccc1N(C(=O)OC)[C@@]32CC4 |
| InChI | InChI=1S/C21H20N2O5/c1-27-18(26)23-15-5-3-2-4-13(15)21-10-11-22-16(24)6-7-19(22)8-9-20(21,23)14(12-19)17(25)28-21/h2-7,14H,8-12H2,1H3/t14-,19-,20-,21?/m1/s1 |
| InChIKey | STACHDUHGOCYFP-XCKWHVFBSA-N |
| Roles Classification |
|---|
| Chemical Role: | Bronsted acid A molecular entity capable of donating a hydron to an acceptor (Brønsted base). |
| ChEBI Ontology |
|---|
| Outgoing Relation(s) |
| Methyl (9R,12R,21S)-15,20-dioxo-19-oxa-8,16-diazahexacyclo[10.6.4.01,9.02,7.09,21.012,16]docosa-2,4,6,13-tetraene-8-carboxylate (CHEBI:182429) is a indolyl carboxylic acid (CHEBI:46867) |
| IUPAC Name |
|---|
| methyl (9R,12R,21S)-15,20-dioxo-19-oxa-8,16-diazahexacyclo[10.6.4.01,9.02,7.09,21.012,16]docosa-2,4,6,13-tetraene-8-carboxylate |